C14H17ClN2O2 — CID 114303639
2-(1,2-benzoxazol-3-yl)-N-(1-chloro-2-methylbutan-2-yl)acetamide (PubChem CID 114303639) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-(1-chloro-2-methylbutan-2-yl)acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-(1-chloro-2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 114303639 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-(1-chloro-2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(CCl)NC(=O)Cc1noc2ccccc12 |
| InChI | InChI=1S/C14H17ClN2O2/c1-3-14(2,9-15)16-13(18)8-11-10-6-4-5-7-12(10)19-17-11/h4-7H,3,8-9H2,1-2H3,(H,16,18) |
| InChIKey | NAXXOWLAMJZRDV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|