C20H17NO6S — CID 4685658
dimethyl 5-(naphthalen-1-ylsulfonylamino)benzene-1,3-dicarboxylate (PubChem CID 4685658) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is dimethyl 5-(naphthalen-1-ylsulfonylamino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(naphthalen-1-ylsulfonylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4685658 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | dimethyl 5-(naphthalen-1-ylsulfonylamino)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2cccc3ccccc23)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H17NO6S/c1-26-19(22)14-10-15(20(23)27-2)12-16(11-14)21-28(24,25)18-9-5-7-13-6-3-4-8-17(13)18/h3-12,21H,1-2H3 |
| InChIKey | ISWFCLWXBARCTP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |