C23H19N3O6S — CID 42247339
methyl 3-[(furan-2-carbonylamino)methyl]-5-(quinolin-8-ylsulfonylamino)benzoate (PubChem CID 42247339) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is methyl 3-[(furan-2-carbonylamino)methyl]-5-(quinolin-8-ylsulfonylamino)benzoate.
| Compound Name | methyl 3-[(furan-2-carbonylamino)methyl]-5-(quinolin-8-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 42247339 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | methyl 3-[(furan-2-carbonylamino)methyl]-5-(quinolin-8-ylsulfonylamino)benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2ccco2)cc(NS(=O)(=O)c2cccc3cccnc23)c1 |
| InChI | InChI=1S/C23H19N3O6S/c1-31-23(28)17-11-15(14-25-22(27)19-7-4-10-32-19)12-18(13-17)26-33(29,30)20-8-2-5-16-6-3-9-24-21(16)20/h2-13,26H,14H2,1H3,(H,25,27) |
| InChIKey | LCIBJRFOMKWEAJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |