C20H16N2O5S — CID 7339253
methyl 2-methyl-5-(quinolin-8-ylsulfonylamino)-1-benzofuran-3-carboxylate (PubChem CID 7339253) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is methyl 2-methyl-5-(quinolin-8-ylsulfonylamino)-1-benzofuran-3-carboxylate.
| Compound Name | methyl 2-methyl-5-(quinolin-8-ylsulfonylamino)-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 7339253 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | methyl 2-methyl-5-(quinolin-8-ylsulfonylamino)-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc2ccc(NS(=O)(=O)c3cccc4cccnc34)cc12 |
| InChI | InChI=1S/C20H16N2O5S/c1-12-18(20(23)26-2)15-11-14(8-9-16(15)27-12)22-28(24,25)17-7-3-5-13-6-4-10-21-19(13)17/h3-11,22H,1-2H3 |
| InChIKey | LCXUDIMBMARWTN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |