C17H12Cl3NO4S — CID 1304958
N-(3-acetyl-2-methyl-1-benzofuran-5-yl)-2,4,5-trichlorobenzenesulfonamide (PubChem CID 1304958) has the molecular formula C17H12Cl3NO4S and a molecular weight of 432.71 g/mol. Its IUPAC name is N-(3-acetyl-2-methyl-1-benzofuran-5-yl)-2,4,5-trichlorobenzenesulfonamide.
| Compound Name | N-(3-acetyl-2-methyl-1-benzofuran-5-yl)-2,4,5-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 1304958 |
| Molecular Formula | C17H12Cl3NO4S |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | N-(3-acetyl-2-methyl-1-benzofuran-5-yl)-2,4,5-trichlorobenzenesulfonamide |
| SMILES | CC(=O)c1c(C)oc2ccc(NS(=O)(=O)c3cc(Cl)c(Cl)cc3Cl)cc12 |
| InChI | InChI=1S/C17H12Cl3NO4S/c1-8(22)17-9(2)25-15-4-3-10(5-11(15)17)21-26(23,24)16-7-13(19)12(18)6-14(16)20/h3-7,21H,1-2H3 |
| InChIKey | ZFEKXZNBOIPVSY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|