C23H20N2O4S — CID 25037862
2-methyl-5-[(2-methylphenyl)sulfonylamino]-N-phenyl-1-benzofuran-3-carboxamide (PubChem CID 25037862) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-methyl-5-[(2-methylphenyl)sulfonylamino]-N-phenyl-1-benzofuran-3-carboxamide.
| Compound Name | 2-methyl-5-[(2-methylphenyl)sulfonylamino]-N-phenyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 25037862 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-methyl-5-[(2-methylphenyl)sulfonylamino]-N-phenyl-1-benzofuran-3-carboxamide |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1ccc2oc(C)c(C(=O)Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C23H20N2O4S/c1-15-8-6-7-11-21(15)30(27,28)25-18-12-13-20-19(14-18)22(16(2)29-20)23(26)24-17-9-4-3-5-10-17/h3-14,25H,1-2H3,(H,24,26) |
| InChIKey | BFHBDWVLSRBXCN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |