C19H19NO5S — CID 25043109
propyl 5-(benzenesulfonamido)-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 25043109) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is propyl 5-(benzenesulfonamido)-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | propyl 5-(benzenesulfonamido)-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 25043109 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | propyl 5-(benzenesulfonamido)-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCCOC(=O)c1c(C)oc2ccc(NS(=O)(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C19H19NO5S/c1-3-11-24-19(21)18-13(2)25-17-10-9-14(12-16(17)18)20-26(22,23)15-7-5-4-6-8-15/h4-10,12,20H,3,11H2,1-2H3 |
| InChIKey | CXWVFTCAKMZGLO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |