C24H20N2O8S — CID 2946060
benzyl 5-[(4-methoxy-3-nitrophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 2946060) has the molecular formula C24H20N2O8S and a molecular weight of 496.50 g/mol. Its IUPAC name is benzyl 5-[(4-methoxy-3-nitrophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | benzyl 5-[(4-methoxy-3-nitrophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 2946060 |
| Molecular Formula | C24H20N2O8S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | benzyl 5-[(4-methoxy-3-nitrophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3oc(C)c(C(=O)OCc4ccccc4)c3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H20N2O8S/c1-15-23(24(27)33-14-16-6-4-3-5-7-16)19-12-17(8-10-21(19)34-15)25-35(30,31)18-9-11-22(32-2)20(13-18)26(28)29/h3-13,25H,14H2,1-2H3 |
| InChIKey | JPYUBQYXJXOINI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|