C24H20O5S — CID 157121027
benzyl 5-(benzenesulfonylmethyl)-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 157121027) has the molecular formula C24H20O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is benzyl 5-(benzenesulfonylmethyl)-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | benzyl 5-(benzenesulfonylmethyl)-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 157121027 |
| Molecular Formula | C24H20O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | benzyl 5-(benzenesulfonylmethyl)-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2ccc(CS(=O)(=O)c3ccccc3)cc2c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H20O5S/c1-17-23(24(25)28-15-18-8-4-2-5-9-18)21-14-19(12-13-22(21)29-17)16-30(26,27)20-10-6-3-7-11-20/h2-14H,15-16H2,1H3 |
| InChIKey | WIEDQKXYGPCDDX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |