C19H18O5S — CID 157318510
methyl 2-methyl-5-[(4-methylphenyl)sulfonylmethyl]-1-benzofuran-3-carboxylate (PubChem CID 157318510) has the molecular formula C19H18O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is methyl 2-methyl-5-[(4-methylphenyl)sulfonylmethyl]-1-benzofuran-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(4-methylphenyl)sulfonylmethyl]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 157318510 |
| Molecular Formula | C19H18O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl 2-methyl-5-[(4-methylphenyl)sulfonylmethyl]-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc2ccc(CS(=O)(=O)c3ccc(C)cc3)cc12 |
| InChI | InChI=1S/C19H18O5S/c1-12-4-7-15(8-5-12)25(21,22)11-14-6-9-17-16(10-14)18(13(2)24-17)19(20)23-3/h4-10H,11H2,1-3H3 |
| InChIKey | UJRWUDHRDWMWLG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |