C20H20O4S — CID 160839014
1-[5-[(4-ethylphenyl)sulfonylmethyl]-2-methyl-1-benzofuran-3-yl]ethanone (PubChem CID 160839014) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is 1-[5-[(4-ethylphenyl)sulfonylmethyl]-2-methyl-1-benzofuran-3-yl]ethanone.
| Compound Name | 1-[5-[(4-ethylphenyl)sulfonylmethyl]-2-methyl-1-benzofuran-3-yl]ethanone |
|---|---|
| PubChem CID | 160839014 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-[5-[(4-ethylphenyl)sulfonylmethyl]-2-methyl-1-benzofuran-3-yl]ethanone |
| SMILES | CCc1ccc(S(=O)(=O)Cc2ccc3oc(C)c(C(C)=O)c3c2)cc1 |
| InChI | InChI=1S/C20H20O4S/c1-4-15-5-8-17(9-6-15)25(22,23)12-16-7-10-19-18(11-16)20(13(2)21)14(3)24-19/h5-11H,4,12H2,1-3H3 |
| InChIKey | JMTSGTGVCZXELP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |