C24H27NO6S — CID 22331187
ethyl 5-[butanoyl-(4-ethylphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 22331187) has the molecular formula C24H27NO6S and a molecular weight of 457.55 g/mol. Its IUPAC name is ethyl 5-[butanoyl-(4-ethylphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[butanoyl-(4-ethylphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 22331187 |
| Molecular Formula | C24H27NO6S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | ethyl 5-[butanoyl-(4-ethylphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCCC(=O)N(c1ccc2oc(C)c(C(=O)OCC)c2c1)S(=O)(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C24H27NO6S/c1-5-8-22(26)25(32(28,29)19-12-9-17(6-2)10-13-19)18-11-14-21-20(15-18)23(16(4)31-21)24(27)30-7-3/h9-15H,5-8H2,1-4H3 |
| InChIKey | COGVZNTXDSCYPO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |