C29H29NO6S — CID 22331803
ethyl 5-[butanoyl-(4-ethylphenyl)sulfonylamino]-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 22331803) has the molecular formula C29H29NO6S and a molecular weight of 519.62 g/mol. Its IUPAC name is ethyl 5-[butanoyl-(4-ethylphenyl)sulfonylamino]-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[butanoyl-(4-ethylphenyl)sulfonylamino]-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 22331803 |
| Molecular Formula | C29H29NO6S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | ethyl 5-[butanoyl-(4-ethylphenyl)sulfonylamino]-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCCC(=O)N(c1ccc2oc(-c3ccccc3)c(C(=O)OCC)c2c1)S(=O)(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C29H29NO6S/c1-4-10-26(31)30(37(33,34)23-16-13-20(5-2)14-17-23)22-15-18-25-24(19-22)27(29(32)35-6-3)28(36-25)21-11-8-7-9-12-21/h7-9,11-19H,4-6,10H2,1-3H3 |
| InChIKey | MPAYKGGFMHHMIT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |