C32H26N2O9S — CID 23833363
ethyl 5-[(4-ethoxyphenyl)sulfonyl-(4-nitrobenzoyl)amino]-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 23833363) has the molecular formula C32H26N2O9S and a molecular weight of 614.63 g/mol. Its IUPAC name is ethyl 5-[(4-ethoxyphenyl)sulfonyl-(4-nitrobenzoyl)amino]-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[(4-ethoxyphenyl)sulfonyl-(4-nitrobenzoyl)amino]-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 23833363 |
| Molecular Formula | C32H26N2O9S |
| Molecular Weight | 614.63 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | ethyl 5-[(4-ethoxyphenyl)sulfonyl-(4-nitrobenzoyl)amino]-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(N(C(=O)c3ccc([N+](=O)[O-])cc3)S(=O)(=O)c3ccc(OCC)cc3)cc12 |
| InChI | InChI=1S/C32H26N2O9S/c1-3-41-25-15-17-26(18-16-25)44(39,40)33(31(35)22-10-12-23(13-11-22)34(37)38)24-14-19-28-27(20-24)29(32(36)42-4-2)30(43-28)21-8-6-5-7-9-21/h5-20H,3-4H2,1-2H3 |
| InChIKey | ZKGMLBUWJASEMW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 146.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.63 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|