C25H19FN2O8S — CID 23917561
ethyl 5-[(4-fluorophenyl)sulfonyl-(4-nitrobenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 23917561) has the molecular formula C25H19FN2O8S and a molecular weight of 526.50 g/mol. Its IUPAC name is ethyl 5-[(4-fluorophenyl)sulfonyl-(4-nitrobenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[(4-fluorophenyl)sulfonyl-(4-nitrobenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 23917561 |
| Molecular Formula | C25H19FN2O8S |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | ethyl 5-[(4-fluorophenyl)sulfonyl-(4-nitrobenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2ccc(N(C(=O)c3ccc([N+](=O)[O-])cc3)S(=O)(=O)c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C25H19FN2O8S/c1-3-35-25(30)23-15(2)36-22-13-10-19(14-21(22)23)27(37(33,34)20-11-6-17(26)7-12-20)24(29)16-4-8-18(9-5-16)28(31)32/h4-14H,3H2,1-2H3 |
| InChIKey | AQULMYZUSSZOPA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 137.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|