C26H23NO6S — CID 2340141
ethyl 5-[benzenesulfonyl-(4-methylbenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 2340141) has the molecular formula C26H23NO6S and a molecular weight of 477.54 g/mol. Its IUPAC name is ethyl 5-[benzenesulfonyl-(4-methylbenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[benzenesulfonyl-(4-methylbenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 2340141 |
| Molecular Formula | C26H23NO6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | ethyl 5-[benzenesulfonyl-(4-methylbenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2ccc(N(C(=O)c3ccc(C)cc3)S(=O)(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C26H23NO6S/c1-4-32-26(29)24-18(3)33-23-15-14-20(16-22(23)24)27(25(28)19-12-10-17(2)11-13-19)34(30,31)21-8-6-5-7-9-21/h5-16H,4H2,1-3H3 |
| InChIKey | UZBUAAAAOQJRQD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |