C24H18ClNO5S — CID 6618120
N-(3-acetyl-2-methyl-1-benzofuran-5-yl)-N-(benzenesulfonyl)-4-chlorobenzamide (PubChem CID 6618120) has the molecular formula C24H18ClNO5S and a molecular weight of 467.93 g/mol. Its IUPAC name is N-(3-acetyl-2-methyl-1-benzofuran-5-yl)-N-(benzenesulfonyl)-4-chlorobenzamide.
| Compound Name | N-(3-acetyl-2-methyl-1-benzofuran-5-yl)-N-(benzenesulfonyl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 6618120 |
| Molecular Formula | C24H18ClNO5S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | N-(3-acetyl-2-methyl-1-benzofuran-5-yl)-N-(benzenesulfonyl)-4-chlorobenzamide |
| SMILES | CC(=O)c1c(C)oc2ccc(N(C(=O)c3ccc(Cl)cc3)S(=O)(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C24H18ClNO5S/c1-15(27)23-16(2)31-22-13-12-19(14-21(22)23)26(24(28)17-8-10-18(25)11-9-17)32(29,30)20-6-4-3-5-7-20/h3-14H,1-2H3 |
| InChIKey | JYYHHWPBMGSDEF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |