C21H20ClNO6S — CID 1110200
methyl 5-[butanoyl-(4-chlorophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 1110200) has the molecular formula C21H20ClNO6S and a molecular weight of 449.91 g/mol. Its IUPAC name is methyl 5-[butanoyl-(4-chlorophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | methyl 5-[butanoyl-(4-chlorophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 1110200 |
| Molecular Formula | C21H20ClNO6S |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | methyl 5-[butanoyl-(4-chlorophenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCCC(=O)N(c1ccc2oc(C)c(C(=O)OC)c2c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClNO6S/c1-4-5-19(24)23(30(26,27)16-9-6-14(22)7-10-16)15-8-11-18-17(12-15)20(13(2)29-18)21(25)28-3/h6-12H,4-5H2,1-3H3 |
| InChIKey | LSIJAFXFPQNMNL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |