C23H25NO6S — CID 6618093
methyl 5-[acetyl-(4-tert-butylphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 6618093) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is methyl 5-[acetyl-(4-tert-butylphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | methyl 5-[acetyl-(4-tert-butylphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 6618093 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | methyl 5-[acetyl-(4-tert-butylphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc2ccc(N(C(C)=O)S(=O)(=O)c3ccc(C(C)(C)C)cc3)cc12 |
| InChI | InChI=1S/C23H25NO6S/c1-14-21(22(26)29-6)19-13-17(9-12-20(19)30-14)24(15(2)25)31(27,28)18-10-7-16(8-11-18)23(3,4)5/h7-13H,1-6H3 |
| InChIKey | JNYDVVWYTHQFGT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |