C24H18ClNO6S — CID 1183885
methyl 5-[benzenesulfonyl-(2-chlorobenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 1183885) has the molecular formula C24H18ClNO6S and a molecular weight of 483.93 g/mol. Its IUPAC name is methyl 5-[benzenesulfonyl-(2-chlorobenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | methyl 5-[benzenesulfonyl-(2-chlorobenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 1183885 |
| Molecular Formula | C24H18ClNO6S |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | methyl 5-[benzenesulfonyl-(2-chlorobenzoyl)amino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc2ccc(N(C(=O)c3ccccc3Cl)S(=O)(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C24H18ClNO6S/c1-15-22(24(28)31-2)19-14-16(12-13-21(19)32-15)26(23(27)18-10-6-7-11-20(18)25)33(29,30)17-8-4-3-5-9-17/h3-14H,1-2H3 |
| InChIKey | KMOXKWDFWLAAPD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |