C21H21NO7S — CID 992565
methyl 5-[acetyl-(4-ethoxyphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 992565) has the molecular formula C21H21NO7S and a molecular weight of 431.47 g/mol. Its IUPAC name is methyl 5-[acetyl-(4-ethoxyphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | methyl 5-[acetyl-(4-ethoxyphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 992565 |
| Molecular Formula | C21H21NO7S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | methyl 5-[acetyl-(4-ethoxyphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOc1ccc(S(=O)(=O)N(C(C)=O)c2ccc3oc(C)c(C(=O)OC)c3c2)cc1 |
| InChI | InChI=1S/C21H21NO7S/c1-5-28-16-7-9-17(10-8-16)30(25,26)22(14(3)23)15-6-11-19-18(12-15)20(13(2)29-19)21(24)27-4/h6-12H,5H2,1-4H3 |
| InChIKey | ATOJVTPBGCURSN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |