C22H23NO7S — CID 992564
ethyl 5-[acetyl-(4-ethoxyphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 992564) has the molecular formula C22H23NO7S and a molecular weight of 445.49 g/mol. Its IUPAC name is ethyl 5-[acetyl-(4-ethoxyphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[acetyl-(4-ethoxyphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 992564 |
| Molecular Formula | C22H23NO7S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | ethyl 5-[acetyl-(4-ethoxyphenyl)sulfonylamino]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2ccc(N(C(C)=O)S(=O)(=O)c3ccc(OCC)cc3)cc12 |
| InChI | InChI=1S/C22H23NO7S/c1-5-28-17-8-10-18(11-9-17)31(26,27)23(15(4)24)16-7-12-20-19(13-16)21(14(3)30-20)22(25)29-6-2/h7-13H,5-6H2,1-4H3 |
| InChIKey | FUWZCMPEHQGFFP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |