C21H19BrO6 — CID 979362
ethyl 6-bromo-2-methyl-5-(2-oxo-2-phenylmethoxyethoxy)-1-benzofuran-3-carboxylate (PubChem CID 979362) has the molecular formula C21H19BrO6 and a molecular weight of 447.28 g/mol. Its IUPAC name is ethyl 6-bromo-2-methyl-5-(2-oxo-2-phenylmethoxyethoxy)-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 6-bromo-2-methyl-5-(2-oxo-2-phenylmethoxyethoxy)-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 979362 |
| Molecular Formula | C21H19BrO6 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | ethyl 6-bromo-2-methyl-5-(2-oxo-2-phenylmethoxyethoxy)-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2cc(Br)c(OCC(=O)OCc3ccccc3)cc12 |
| InChI | InChI=1S/C21H19BrO6/c1-3-25-21(24)20-13(2)28-17-10-16(22)18(9-15(17)20)26-12-19(23)27-11-14-7-5-4-6-8-14/h4-10H,3,11-12H2,1-2H3 |
| InChIKey | OFNHSCVYAKYRJX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |