C22H21BrO6 — CID 2919964
ethyl 6-bromo-5-(2-ethoxy-2-oxo-1-phenylethoxy)-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 2919964) has the molecular formula C22H21BrO6 and a molecular weight of 461.31 g/mol. Its IUPAC name is ethyl 6-bromo-5-(2-ethoxy-2-oxo-1-phenylethoxy)-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-(2-ethoxy-2-oxo-1-phenylethoxy)-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 2919964 |
| Molecular Formula | C22H21BrO6 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | ethyl 6-bromo-5-(2-ethoxy-2-oxo-1-phenylethoxy)-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2cc(Br)c(OC(C(=O)OCC)c3ccccc3)cc12 |
| InChI | InChI=1S/C22H21BrO6/c1-4-26-21(24)19-13(3)28-17-12-16(23)18(11-15(17)19)29-20(22(25)27-5-2)14-9-7-6-8-10-14/h6-12,20H,4-5H2,1-3H3 |
| InChIKey | DVDGEAVPECVRKE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |