C12H11BrO4 — CID 687106
ethyl 6-bromo-5-hydroxy-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 687106) has the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. Its IUPAC name is ethyl 6-bromo-5-hydroxy-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-hydroxy-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 687106 |
| Molecular Formula | C12H11BrO4 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | ethyl 6-bromo-5-hydroxy-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2cc(Br)c(O)cc12 |
| InChI | InChI=1S/C12H11BrO4/c1-3-16-12(15)11-6(2)17-10-5-8(13)9(14)4-7(10)11/h4-5,14H,3H2,1-2H3 |
| InChIKey | BHMIROPXSMFXIR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |