C13H13BrO4S — CID 14469048
ethyl 6-bromo-5-methoxy-2-(sulfanylmethyl)-1-benzofuran-3-carboxylate (PubChem CID 14469048) has the molecular formula C13H13BrO4S and a molecular weight of 345.21 g/mol. Its IUPAC name is ethyl 6-bromo-5-methoxy-2-(sulfanylmethyl)-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-methoxy-2-(sulfanylmethyl)-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 14469048 |
| Molecular Formula | C13H13BrO4S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | ethyl 6-bromo-5-methoxy-2-(sulfanylmethyl)-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(CS)oc2cc(Br)c(OC)cc12 |
| InChI | InChI=1S/C13H13BrO4S/c1-3-17-13(15)12-7-4-10(16-2)8(14)5-9(7)18-11(12)6-19/h4-5,19H,3,6H2,1-2H3 |
| InChIKey | MPAHUWWSPGGRMF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 48.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|