C14H16BrNO3 — CID 748686
ethyl 6-bromo-5-methoxy-1,2-dimethylindole-3-carboxylate (PubChem CID 748686) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is ethyl 6-bromo-5-methoxy-1,2-dimethylindole-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-methoxy-1,2-dimethylindole-3-carboxylate |
|---|---|
| PubChem CID | 748686 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | ethyl 6-bromo-5-methoxy-1,2-dimethylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C)c2cc(Br)c(OC)cc12 |
| InChI | InChI=1S/C14H16BrNO3/c1-5-19-14(17)13-8(2)16(3)11-7-10(15)12(18-4)6-9(11)13/h6-7H,5H2,1-4H3 |
| InChIKey | WITVCGMVZQKKIW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |