C13H14FNO3 — CID 71033064
ethyl 6-fluoro-5-hydroxy-1,2-dimethylindole-3-carboxylate (PubChem CID 71033064) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is ethyl 6-fluoro-5-hydroxy-1,2-dimethylindole-3-carboxylate.
| Compound Name | ethyl 6-fluoro-5-hydroxy-1,2-dimethylindole-3-carboxylate |
|---|---|
| PubChem CID | 71033064 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | ethyl 6-fluoro-5-hydroxy-1,2-dimethylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C)c2cc(F)c(O)cc12 |
| InChI | InChI=1S/C13H14FNO3/c1-4-18-13(17)12-7(2)15(3)10-6-9(14)11(16)5-8(10)12/h5-6,16H,4H2,1-3H3 |
| InChIKey | SGVYIAVVQBMXIE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |