C15H20BrN2O3+ — CID 3261306
(6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl-dimethylazanium (PubChem CID 3261306) has the molecular formula C15H20BrN2O3+ and a molecular weight of 356.24 g/mol. Its IUPAC name is (6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl-dimethylazanium.
| Compound Name | (6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl-dimethylazanium |
|---|---|
| PubChem CID | 3261306 |
| Molecular Formula | C15H20BrN2O3+ |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl-dimethylazanium |
| SMILES | CCOC(=O)c1c(C[NH+](C)C)n(C)c2cc(Br)c(O)cc12 |
| InChI | InChI=1S/C15H19BrN2O3/c1-5-21-15(20)14-9-6-13(19)10(16)7-11(9)18(4)12(14)8-17(2)3/h6-7,19H,5,8H2,1-4H3/p+1 |
| InChIKey | RAAWEGPXSWOQOA-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 55.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |