C20H22BrN2O3+ — CID 2265304
benzyl-[(6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl]azanium (PubChem CID 2265304) has the molecular formula C20H22BrN2O3+ and a molecular weight of 418.31 g/mol. Its IUPAC name is benzyl-[(6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl]azanium.
| Compound Name | benzyl-[(6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 2265304 |
| Molecular Formula | C20H22BrN2O3+ |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | benzyl-[(6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl]azanium |
| SMILES | CCOC(=O)c1c(C[NH2+]Cc2ccccc2)n(C)c2cc(Br)c(O)cc12 |
| InChI | InChI=1S/C20H21BrN2O3/c1-3-26-20(25)19-14-9-18(24)15(21)10-16(14)23(2)17(19)12-22-11-13-7-5-4-6-8-13/h4-10,22,24H,3,11-12H2,1-2H3/p+1 |
| InChIKey | XSUUZUDUNDLVQZ-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 68.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |