C27H34BrN3O4 — CID 71627361
ethyl 6-bromo-5-hydroxy-1-phenyl-2-[[4-(2-propoxyethyl)piperazin-1-yl]methyl]indole-3-carboxylate (PubChem CID 71627361) has the molecular formula C27H34BrN3O4 and a molecular weight of 544.49 g/mol. Its IUPAC name is ethyl 6-bromo-5-hydroxy-1-phenyl-2-[[4-(2-propoxyethyl)piperazin-1-yl]methyl]indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-hydroxy-1-phenyl-2-[[4-(2-propoxyethyl)piperazin-1-yl]methyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 71627361 |
| Molecular Formula | C27H34BrN3O4 |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | ethyl 6-bromo-5-hydroxy-1-phenyl-2-[[4-(2-propoxyethyl)piperazin-1-yl]methyl]indole-3-carboxylate |
| SMILES | CCCOCCN1CCN(Cc2c(C(=O)OCC)c3cc(O)c(Br)cc3n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C27H34BrN3O4/c1-3-15-34-16-14-29-10-12-30(13-11-29)19-24-26(27(33)35-4-2)21-17-25(32)22(28)18-23(21)31(24)20-8-6-5-7-9-20/h5-9,17-18,32H,3-4,10-16,19H2,1-2H3 |
| InChIKey | GUTIOLNTFLXCAW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|