C31H33N3O4 — CID 4916799
ethyl 5-acetyloxy-2-[[4-(2-methylphenyl)piperazin-1-yl]methyl]-1-phenylindole-3-carboxylate (PubChem CID 4916799) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is ethyl 5-acetyloxy-2-[[4-(2-methylphenyl)piperazin-1-yl]methyl]-1-phenylindole-3-carboxylate.
| Compound Name | ethyl 5-acetyloxy-2-[[4-(2-methylphenyl)piperazin-1-yl]methyl]-1-phenylindole-3-carboxylate |
|---|---|
| PubChem CID | 4916799 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | ethyl 5-acetyloxy-2-[[4-(2-methylphenyl)piperazin-1-yl]methyl]-1-phenylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN2CCN(c3ccccc3C)CC2)n(-c2ccccc2)c2ccc(OC(C)=O)cc12 |
| InChI | InChI=1S/C31H33N3O4/c1-4-37-31(36)30-26-20-25(38-23(3)35)14-15-28(26)34(24-11-6-5-7-12-24)29(30)21-32-16-18-33(19-17-32)27-13-9-8-10-22(27)2/h5-15,20H,4,16-19,21H2,1-3H3 |
| InChIKey | IJGHDZJSXYQZPB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|