C62H66Br2N8O12 — CID 175666889
1,4-dioxane;bis(ethyl 6-bromo-5-methoxy-2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1-phenylindole-3-carboxylate) (PubChem CID 175666889) has the molecular formula C62H66Br2N8O12 and a molecular weight of 1275.06 g/mol. Its IUPAC name is 1,4-dioxane;bis(ethyl 6-bromo-5-methoxy-2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1-phenylindole-3-carboxylate).
| Compound Name | 1,4-dioxane;bis(ethyl 6-bromo-5-methoxy-2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1-phenylindole-3-carboxylate) |
|---|---|
| PubChem CID | 175666889 |
| Molecular Formula | C62H66Br2N8O12 |
| Molecular Weight | 1275.06 g/mol |
| Exact Mass | 1272.32 |
| IUPAC Name | 1,4-dioxane;bis(ethyl 6-bromo-5-methoxy-2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1-phenylindole-3-carboxylate) |
| SMILES | C1COCCO1.CCOC(=O)c1c(CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n(-c2ccccc2)c2cc(Br)c(OC)cc12.CCOC(=O)c1c(CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n(-c2ccccc2)c2cc(Br)c(OC)cc12 |
| InChI | InChI=1S/2C29H29BrN4O5.C4H8O2/c2*1-3-39-29(35)28-23-17-27(38-2)24(30)18-25(23)33(21-7-5-4-6-8-21)26(28)19-31-13-15-32(16-14-31)20-9-11-22(12-10-20)34(36)37;1-2-6-4-3-5-1/h2*4-12,17-18H,3,13-16,19H2,1-2H3;1-4H2 |
| InChIKey | ZBSJWIWLOBDWGT-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 198.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1275.06 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|