C23H26BrN3O3 — CID 5300753
ethyl 6-bromo-5-methoxy-1-phenyl-2-(piperazin-1-ylmethyl)indole-3-carboxylate (PubChem CID 5300753) has the molecular formula C23H26BrN3O3 and a molecular weight of 472.38 g/mol. Its IUPAC name is ethyl 6-bromo-5-methoxy-1-phenyl-2-(piperazin-1-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-methoxy-1-phenyl-2-(piperazin-1-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 5300753 |
| Molecular Formula | C23H26BrN3O3 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | ethyl 6-bromo-5-methoxy-1-phenyl-2-(piperazin-1-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN2CCNCC2)n(-c2ccccc2)c2cc(Br)c(OC)cc12 |
| InChI | InChI=1S/C23H26BrN3O3/c1-3-30-23(28)22-17-13-21(29-2)18(24)14-19(17)27(16-7-5-4-6-8-16)20(22)15-26-11-9-25-10-12-26/h4-8,13-14,25H,3,9-12,15H2,1-2H3 |
| InChIKey | BXHLAEQCEUMQTL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |