C23H27BrN2O3S — CID 124799782
ethyl 2-[(2-aminophenyl)sulfanylmethyl]-6-bromo-1-butyl-5-methoxyindole-3-carboxylate (PubChem CID 124799782) has the molecular formula C23H27BrN2O3S and a molecular weight of 491.45 g/mol. Its IUPAC name is ethyl 2-[(2-aminophenyl)sulfanylmethyl]-6-bromo-1-butyl-5-methoxyindole-3-carboxylate.
| Compound Name | ethyl 2-[(2-aminophenyl)sulfanylmethyl]-6-bromo-1-butyl-5-methoxyindole-3-carboxylate |
|---|---|
| PubChem CID | 124799782 |
| Molecular Formula | C23H27BrN2O3S |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | ethyl 2-[(2-aminophenyl)sulfanylmethyl]-6-bromo-1-butyl-5-methoxyindole-3-carboxylate |
| SMILES | CCCCn1c(CSc2ccccc2N)c(C(=O)OCC)c2cc(OC)c(Br)cc21 |
| InChI | InChI=1S/C23H27BrN2O3S/c1-4-6-11-26-18-13-16(24)20(28-3)12-15(18)22(23(27)29-5-2)19(26)14-30-21-10-8-7-9-17(21)25/h7-10,12-13H,4-6,11,14,25H2,1-3H3 |
| InChIKey | FKNGTETYUHLGDY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|