C22H23Br2NO3 — CID 91800373
ethyl 6-bromo-2-(3-bromopropyl)-1-methyl-5-phenylmethoxyindole-3-carboxylate (PubChem CID 91800373) has the molecular formula C22H23Br2NO3 and a molecular weight of 509.24 g/mol. Its IUPAC name is ethyl 6-bromo-2-(3-bromopropyl)-1-methyl-5-phenylmethoxyindole-3-carboxylate.
| Compound Name | ethyl 6-bromo-2-(3-bromopropyl)-1-methyl-5-phenylmethoxyindole-3-carboxylate |
|---|---|
| PubChem CID | 91800373 |
| Molecular Formula | C22H23Br2NO3 |
| Molecular Weight | 509.24 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | ethyl 6-bromo-2-(3-bromopropyl)-1-methyl-5-phenylmethoxyindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CCCBr)n(C)c2cc(Br)c(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C22H23Br2NO3/c1-3-27-22(26)21-16-12-20(28-14-15-8-5-4-6-9-15)17(24)13-19(16)25(2)18(21)10-7-11-23/h4-6,8-9,12-13H,3,7,10-11,14H2,1-2H3 |
| InChIKey | NYTICPFBBBWDGP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.24 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|