C17H24BrN2O3+ — CID 6962473
(6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl-diethylazanium (PubChem CID 6962473) has the molecular formula C17H24BrN2O3+ and a molecular weight of 384.29 g/mol. Its IUPAC name is (6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl-diethylazanium.
| Compound Name | (6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl-diethylazanium |
|---|---|
| PubChem CID | 6962473 |
| Molecular Formula | C17H24BrN2O3+ |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (6-bromo-3-ethoxycarbonyl-5-hydroxy-1-methylindol-2-yl)methyl-diethylazanium |
| SMILES | CCOC(=O)c1c(C[NH+](CC)CC)n(C)c2cc(Br)c(O)cc12 |
| InChI | InChI=1S/C17H23BrN2O3/c1-5-20(6-2)10-14-16(17(22)23-7-3)11-8-15(21)12(18)9-13(11)19(14)4/h8-9,21H,5-7,10H2,1-4H3/p+1 |
| InChIKey | IIMWBFQWFOAHPG-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 55.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |