C17H21FN2O3 — CID 143754515
ethyl 6-fluoro-5-hydroxy-1-methyl-2-(pyrrolidin-1-ylmethyl)indole-3-carboxylate (PubChem CID 143754515) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is ethyl 6-fluoro-5-hydroxy-1-methyl-2-(pyrrolidin-1-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 6-fluoro-5-hydroxy-1-methyl-2-(pyrrolidin-1-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 143754515 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | ethyl 6-fluoro-5-hydroxy-1-methyl-2-(pyrrolidin-1-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN2CCCC2)n(C)c2cc(F)c(O)cc12 |
| InChI | InChI=1S/C17H21FN2O3/c1-3-23-17(22)16-11-8-15(21)12(18)9-13(11)19(2)14(16)10-20-6-4-5-7-20/h8-9,21H,3-7,10H2,1-2H3 |
| InChIKey | MFHNGCKCSGOBPX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |