C23H23F2NO5 — CID 122644523
ethyl 2-(3,5-difluoro-4-hydroxyphenyl)-5-hydroxy-4-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxylate (PubChem CID 122644523) has the molecular formula C23H23F2NO5 and a molecular weight of 431.44 g/mol. Its IUPAC name is ethyl 2-(3,5-difluoro-4-hydroxyphenyl)-5-hydroxy-4-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-(3,5-difluoro-4-hydroxyphenyl)-5-hydroxy-4-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 122644523 |
| Molecular Formula | C23H23F2NO5 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | ethyl 2-(3,5-difluoro-4-hydroxyphenyl)-5-hydroxy-4-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cc(F)c(O)c(F)c2)oc2ccc(O)c(CN3CCCCC3)c12 |
| InChI | InChI=1S/C23H23F2NO5/c1-2-30-23(29)20-19-14(12-26-8-4-3-5-9-26)17(27)6-7-18(19)31-22(20)13-10-15(24)21(28)16(25)11-13/h6-7,10-11,27-28H,2-5,8-9,12H2,1H3 |
| InChIKey | CPYPHVZLOILKNB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|