C22H23FN2O4 — CID 122644522
2-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-N-methyl-4-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxamide (PubChem CID 122644522) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-N-methyl-4-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxamide.
| Compound Name | 2-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-N-methyl-4-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 122644522 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-N-methyl-4-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(O)c(F)c2)oc2ccc(O)c(CN3CCCCC3)c12 |
| InChI | InChI=1S/C22H23FN2O4/c1-24-22(28)20-19-14(12-25-9-3-2-4-10-25)16(26)7-8-18(19)29-21(20)13-5-6-17(27)15(23)11-13/h5-8,11,26-27H,2-4,9-10,12H2,1H3,(H,24,28) |
| InChIKey | OKVHQWLEZXCYEZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|