C23H32N2O3 — CID 7540289
4-(azepan-1-ylmethyl)-N-cyclohexyl-5-hydroxy-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 7540289) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 4-(azepan-1-ylmethyl)-N-cyclohexyl-5-hydroxy-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 4-(azepan-1-ylmethyl)-N-cyclohexyl-5-hydroxy-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 7540289 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 4-(azepan-1-ylmethyl)-N-cyclohexyl-5-hydroxy-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2ccc(O)c(CN3CCCCCC3)c2c1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H32N2O3/c1-16-21(23(27)24-17-9-5-4-6-10-17)22-18(19(26)11-12-20(22)28-16)15-25-13-7-2-3-8-14-25/h11-12,17,26H,2-10,13-15H2,1H3,(H,24,27) |
| InChIKey | WVUITDWABKAKME-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|