C24H28N2O3 — CID 7540060
N-benzyl-5-hydroxy-2-methyl-4-[[(2S)-2-methylpiperidin-1-yl]methyl]-1-benzofuran-3-carboxamide (PubChem CID 7540060) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-benzyl-5-hydroxy-2-methyl-4-[[(2S)-2-methylpiperidin-1-yl]methyl]-1-benzofuran-3-carboxamide.
| Compound Name | N-benzyl-5-hydroxy-2-methyl-4-[[(2S)-2-methylpiperidin-1-yl]methyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 7540060 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-benzyl-5-hydroxy-2-methyl-4-[[(2S)-2-methylpiperidin-1-yl]methyl]-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2ccc(O)c(CN3CCCC[C@@H]3C)c2c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H28N2O3/c1-16-8-6-7-13-26(16)15-19-20(27)11-12-21-23(19)22(17(2)29-21)24(28)25-14-18-9-4-3-5-10-18/h3-5,9-12,16,27H,6-8,13-15H2,1-2H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | RCFXSVNPVUOLKO-INIZCTEOSA-N |
| XLogP | 4.75 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|