C24H28ClNO4 — CID 2891801
ethyl 5-hydroxy-4-[(2-methylpiperidin-1-yl)methyl]-2-phenyl-1-benzofuran-3-carboxylate;hydrochloride (PubChem CID 2891801) has the molecular formula C24H28ClNO4 and a molecular weight of 429.94 g/mol. Its IUPAC name is ethyl 5-hydroxy-4-[(2-methylpiperidin-1-yl)methyl]-2-phenyl-1-benzofuran-3-carboxylate;hydrochloride.
| Compound Name | ethyl 5-hydroxy-4-[(2-methylpiperidin-1-yl)methyl]-2-phenyl-1-benzofuran-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 2891801 |
| Molecular Formula | C24H28ClNO4 |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | ethyl 5-hydroxy-4-[(2-methylpiperidin-1-yl)methyl]-2-phenyl-1-benzofuran-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(O)c(CN3CCCCC3C)c12.Cl |
| InChI | InChI=1S/C24H27NO4.ClH/c1-3-28-24(27)22-21-18(15-25-14-8-7-9-16(25)2)19(26)12-13-20(21)29-23(22)17-10-5-4-6-11-17;/h4-6,10-13,16,26H,3,7-9,14-15H2,1-2H3;1H |
| InChIKey | SMZDASMPKSOUFK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|