C22H23ClNO5- — CID 46863701
ethyl 5-hydroxy-4-(morpholin-4-ylmethyl)-2-phenyl-1-benzofuran-3-carboxylate chloride (PubChem CID 46863701) has the molecular formula C22H23ClNO5- and a molecular weight of 416.88 g/mol. Its IUPAC name is ethyl 5-hydroxy-4-(morpholin-4-ylmethyl)-2-phenyl-1-benzofuran-3-carboxylate chloride.
| Compound Name | ethyl 5-hydroxy-4-(morpholin-4-ylmethyl)-2-phenyl-1-benzofuran-3-carboxylate chloride |
|---|---|
| PubChem CID | 46863701 |
| Molecular Formula | C22H23ClNO5- |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | ethyl 5-hydroxy-4-(morpholin-4-ylmethyl)-2-phenyl-1-benzofuran-3-carboxylate chloride |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(O)c(CN3CCOCC3)c12.[Cl-] |
| InChI | InChI=1S/C22H23NO5.ClH/c1-2-27-22(25)20-19-16(14-23-10-12-26-13-11-23)17(24)8-9-18(19)28-21(20)15-6-4-3-5-7-15;/h3-9,24H,2,10-14H2,1H3;1H/p-1 |
| InChIKey | MFMHWTVWWHFPLG-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|