C17H13ClO4 — CID 23267424
ethyl 4-chloro-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate (PubChem CID 23267424) has the molecular formula C17H13ClO4 and a molecular weight of 316.74 g/mol. Its IUPAC name is ethyl 4-chloro-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 4-chloro-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 23267424 |
| Molecular Formula | C17H13ClO4 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | ethyl 4-chloro-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(O)c(Cl)c12 |
| InChI | InChI=1S/C17H13ClO4/c1-2-21-17(20)14-13-12(9-8-11(19)15(13)18)22-16(14)10-6-4-3-5-7-10/h3-9,19H,2H2,1H3 |
| InChIKey | JWSGVZWTADIFSS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |