C54H64N2O14 — CID 44786236
2,3-dihydroxybutanedioic acid;bis(ethyl 4-[(2,6-dimethylpiperidin-1-yl)methyl]-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate) (PubChem CID 44786236) has the molecular formula C54H64N2O14 and a molecular weight of 965.11 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;bis(ethyl 4-[(2,6-dimethylpiperidin-1-yl)methyl]-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate).
| Compound Name | 2,3-dihydroxybutanedioic acid;bis(ethyl 4-[(2,6-dimethylpiperidin-1-yl)methyl]-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate) |
|---|---|
| PubChem CID | 44786236 |
| Molecular Formula | C54H64N2O14 |
| Molecular Weight | 965.11 g/mol |
| Exact Mass | 964.44 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;bis(ethyl 4-[(2,6-dimethylpiperidin-1-yl)methyl]-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate) |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2ccc(O)c(CN3C(C)CCCC3C)c12.CCOC(=O)c1c(-c2ccccc2)oc2ccc(O)c(CN3C(C)CCCC3C)c12.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/2C25H29NO4.C4H6O6/c2*1-4-29-25(28)23-22-19(15-26-16(2)9-8-10-17(26)3)20(27)13-14-21(22)30-24(23)18-11-6-5-7-12-18;5-1(3(7)8)2(6)4(9)10/h2*5-7,11-14,16-17,27H,4,8-10,15H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | UYNYSOZANOZNOK-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 240.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 70 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.11 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|