C18H23NO4 — CID 16800660
methyl 5-hydroxy-2-methyl-4-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-carboxylate (PubChem CID 16800660) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl 5-hydroxy-2-methyl-4-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-carboxylate.
| Compound Name | methyl 5-hydroxy-2-methyl-4-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 16800660 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl 5-hydroxy-2-methyl-4-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc2ccc(O)c(CN3CCCCC3C)c12 |
| InChI | InChI=1S/C18H23NO4/c1-11-6-4-5-9-19(11)10-13-14(20)7-8-15-17(13)16(12(2)23-15)18(21)22-3/h7-8,11,20H,4-6,9-10H2,1-3H3 |
| InChIKey | FGHUJSZNMQGDEF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|