C16H19ClNO4- — CID 53314502
1-[5-hydroxy-2-methyl-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]ethanone chloride (PubChem CID 53314502) has the molecular formula C16H19ClNO4- and a molecular weight of 324.78 g/mol. Its IUPAC name is 1-[5-hydroxy-2-methyl-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]ethanone chloride.
| Compound Name | 1-[5-hydroxy-2-methyl-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]ethanone chloride |
|---|---|
| PubChem CID | 53314502 |
| Molecular Formula | C16H19ClNO4- |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-[5-hydroxy-2-methyl-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]ethanone chloride |
| SMILES | CC(=O)c1c(C)oc2ccc(O)c(CN3CCOCC3)c12.[Cl-] |
| InChI | InChI=1S/C16H19NO4.ClH/c1-10(18)15-11(2)21-14-4-3-13(19)12(16(14)15)9-17-5-7-20-8-6-17;/h3-4,19H,5-9H2,1-2H3;1H/p-1 |
| InChIKey | FFRIQBTYSKMTAB-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|