C18H17NO5 — CID 1426444
2-(furan-2-yl)-6-hydroxy-5-(morpholin-4-ylmethyl)chromen-4-one (PubChem CID 1426444) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-hydroxy-5-(morpholin-4-ylmethyl)chromen-4-one.
| Compound Name | 2-(furan-2-yl)-6-hydroxy-5-(morpholin-4-ylmethyl)chromen-4-one |
|---|---|
| PubChem CID | 1426444 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-(furan-2-yl)-6-hydroxy-5-(morpholin-4-ylmethyl)chromen-4-one |
| SMILES | O=c1cc(-c2ccco2)oc2ccc(O)c(CN3CCOCC3)c12 |
| InChI | InChI=1S/C18H17NO5/c20-13-3-4-16-18(12(13)11-19-5-8-22-9-6-19)14(21)10-17(24-16)15-2-1-7-23-15/h1-4,7,10,20H,5-6,8-9,11H2 |
| InChIKey | YJHHTYMOUMTCIF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|