C24H21NO4 — CID 127254802
[5-hydroxy-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]-naphthalen-2-ylmethanone (PubChem CID 127254802) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is [5-hydroxy-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]-naphthalen-2-ylmethanone.
| Compound Name | [5-hydroxy-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 127254802 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [5-hydroxy-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]-naphthalen-2-ylmethanone |
| SMILES | O=C(c1ccc2ccccc2c1)c1coc2ccc(O)c(CN3CCOCC3)c12 |
| InChI | InChI=1S/C24H21NO4/c26-21-7-8-22-23(19(21)14-25-9-11-28-12-10-25)20(15-29-22)24(27)18-6-5-16-3-1-2-4-17(16)13-18/h1-8,13,15,26H,9-12,14H2 |
| InChIKey | PMAOSRMDDLMPRW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|